C18H24O4 — CID 101433173
(1R,2R,3S,7R,8R,10S)-3,10-dihydroxy-3,5,6,8,10,12-hexamethyltricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione (PubChem CID 101433173) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (1R,2R,3S,7R,8R,10S)-3,10-dihydroxy-3,5,6,8,10,12-hexamethyltricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione.
| Compound Name | (1R,2R,3S,7R,8R,10S)-3,10-dihydroxy-3,5,6,8,10,12-hexamethyltricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
|---|---|
| PubChem CID | 101433173 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (1R,2R,3S,7R,8R,10S)-3,10-dihydroxy-3,5,6,8,10,12-hexamethyltricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
| SMILES | CC1=C[C@@H]2[C@H]3[C@H](C(C)=C(C)C(=O)[C@@]3(C)O)[C@@]1(C)C(=O)[C@@]2(C)O |
| InChI | InChI=1S/C18H24O4/c1-8-7-11-13-12(16(8,4)15(20)17(11,5)21)9(2)10(3)14(19)18(13,6)22/h7,11-13,21-22H,1-6H3/t11-,12+,13+,16+,17+,18+/m1/s1 |
| InChIKey | MFVSVWXLEDCITO-OQQRLUJQSA-N |
| XLogP | 1.80 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|