C18H12INO3 — CID 101433323
3-hydroxy-3-(2-hydroxynaphthalen-1-yl)-5-iodo-1H-indol-2-one (PubChem CID 101433323) has the molecular formula C18H12INO3 and a molecular weight of 417.20 g/mol. Its IUPAC name is 3-hydroxy-3-(2-hydroxynaphthalen-1-yl)-5-iodo-1H-indol-2-one.
| Compound Name | 3-hydroxy-3-(2-hydroxynaphthalen-1-yl)-5-iodo-1H-indol-2-one |
|---|---|
| PubChem CID | 101433323 |
| Molecular Formula | C18H12INO3 |
| Molecular Weight | 417.20 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | 3-hydroxy-3-(2-hydroxynaphthalen-1-yl)-5-iodo-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(I)cc2C1(O)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C18H12INO3/c19-11-6-7-14-13(9-11)18(23,17(22)20-14)16-12-4-2-1-3-10(12)5-8-15(16)21/h1-9,21,23H,(H,20,22) |
| InChIKey | YZVBIICLHZTEPQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.20 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|