C27H52O2Si — CID 101433571
(4R,6S,8E,12E)-4,8,12-triethyl-6-methyl-5-triethylsilyloxytetradeca-8,12-dien-3-one (PubChem CID 101433571) has the molecular formula C27H52O2Si and a molecular weight of 436.80 g/mol. Its IUPAC name is (4R,6S,8E,12E)-4,8,12-triethyl-6-methyl-5-triethylsilyloxytetradeca-8,12-dien-3-one.
| Compound Name | (4R,6S,8E,12E)-4,8,12-triethyl-6-methyl-5-triethylsilyloxytetradeca-8,12-dien-3-one |
|---|---|
| PubChem CID | 101433571 |
| Molecular Formula | C27H52O2Si |
| Molecular Weight | 436.80 g/mol |
| Exact Mass | 436.37 |
| IUPAC Name | (4R,6S,8E,12E)-4,8,12-triethyl-6-methyl-5-triethylsilyloxytetradeca-8,12-dien-3-one |
| SMILES | C/C=C(\CC)CC/C=C(\CC)C[C@H](C)C(O[Si](CC)(CC)CC)[C@@H](CC)C(=O)CC |
| InChI | InChI=1S/C27H52O2Si/c1-10-23(11-2)19-18-20-24(12-3)21-22(9)27(25(13-4)26(28)14-5)29-30(15-6,16-7)17-8/h10,20,22,25,27H,11-19,21H2,1-9H3/b23-10+,24-20+/t22-,25-,27?/m0/s1 |
| InChIKey | ZEWSFFAGYWTFNU-BVGYSWQASA-N |
| XLogP | 8.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.80 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|