C21H30N2O3 — CID 101433940
benzyl N-[(2R)-1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-3,3-dimethyl-1-oxopent-4-en-2-yl]carbamate (PubChem CID 101433940) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is benzyl N-[(2R)-1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-3,3-dimethyl-1-oxopent-4-en-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-3,3-dimethyl-1-oxopent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 101433940 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | benzyl N-[(2R)-1-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-3,3-dimethyl-1-oxopent-4-en-2-yl]carbamate |
| SMILES | C=CC(C)(C)[C@@H](NC(=O)OCc1ccccc1)C(=O)N1[C@H](C)CC[C@H]1C |
| InChI | InChI=1S/C21H30N2O3/c1-6-21(4,5)18(19(24)23-15(2)12-13-16(23)3)22-20(25)26-14-17-10-8-7-9-11-17/h6-11,15-16,18H,1,12-14H2,2-5H3,(H,22,25)/t15-,16-,18+/m1/s1 |
| InChIKey | ZMZXPFLKJBECNT-NUJGCVRESA-N |
| XLogP | 3.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|