C12H7BF3NO2 — CID 101434288
2-(1,3,2-benzodioxaborol-2-yl)-3,5,6-trifluoro-4-methylpyridine (PubChem CID 101434288) has the molecular formula C12H7BF3NO2 and a molecular weight of 265.00 g/mol. Its IUPAC name is 2-(1,3,2-benzodioxaborol-2-yl)-3,5,6-trifluoro-4-methylpyridine.
| Compound Name | 2-(1,3,2-benzodioxaborol-2-yl)-3,5,6-trifluoro-4-methylpyridine |
|---|---|
| PubChem CID | 101434288 |
| Molecular Formula | C12H7BF3NO2 |
| Molecular Weight | 265.00 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 2-(1,3,2-benzodioxaborol-2-yl)-3,5,6-trifluoro-4-methylpyridine |
| SMILES | Cc1c(F)c(F)nc(B2Oc3ccccc3O2)c1F |
| InChI | InChI=1S/C12H7BF3NO2/c1-6-9(14)11(17-12(16)10(6)15)13-18-7-4-2-3-5-8(7)19-13/h2-5H,1H3 |
| InChIKey | JWUBVEXKFCGZBQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.00 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|