C13H21NO2 — CID 101436375
methyl (1R,5S)-1-butyl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 101436375) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is methyl (1R,5S)-1-butyl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | methyl (1R,5S)-1-butyl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 101436375 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | methyl (1R,5S)-1-butyl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CCCC[C@]12C=CC[C@H](CC1)N2C(=O)OC |
| InChI | InChI=1S/C13H21NO2/c1-3-4-8-13-9-5-6-11(7-10-13)14(13)12(15)16-2/h5,9,11H,3-4,6-8,10H2,1-2H3/t11-,13+/m1/s1 |
| InChIKey | JFZAIYQYLPDIRA-YPMHNXCESA-N |
| XLogP | 3.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|