C23H41NO4Si — CID 23636284
methyl (1R,2S,4R,5S)-1-butyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-4-prop-2-enyl-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 23636284) has the molecular formula C23H41NO4Si and a molecular weight of 423.67 g/mol. Its IUPAC name is methyl (1R,2S,4R,5S)-1-butyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-4-prop-2-enyl-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | methyl (1R,2S,4R,5S)-1-butyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-4-prop-2-enyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 23636284 |
| Molecular Formula | C23H41NO4Si |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | methyl (1R,2S,4R,5S)-1-butyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxo-4-prop-2-enyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C=CC[C@H]1C(=O)[C@H](CO[Si](C)(C)C(C)(C)C)[C@@]2(CCCC)CC[C@@H]1N2C(=O)OC |
| InChI | InChI=1S/C23H41NO4Si/c1-9-11-14-23-15-13-19(24(23)21(26)27-6)17(12-10-2)20(25)18(23)16-28-29(7,8)22(3,4)5/h10,17-19H,2,9,11-16H2,1,3-8H3/t17-,18+,19+,23-/m1/s1 |
| InChIKey | SOTAVINCCKVILQ-GKAYAJSDSA-N |
| XLogP | 5.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|