C21H40N2O7Si — CID 175991750
butyl 4-[[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-1-oxopropan-2-yl]carbamoyloxy]piperidine-1-carboxylate (PubChem CID 175991750) has the molecular formula C21H40N2O7Si and a molecular weight of 460.64 g/mol. Its IUPAC name is butyl 4-[[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-1-oxopropan-2-yl]carbamoyloxy]piperidine-1-carboxylate.
| Compound Name | butyl 4-[[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-1-oxopropan-2-yl]carbamoyloxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175991750 |
| Molecular Formula | C21H40N2O7Si |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | butyl 4-[[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-1-oxopropan-2-yl]carbamoyloxy]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(OC(=O)N[C@@H](CO[Si](C)(C)C(C)(C)C)C(=O)OC)CC1 |
| InChI | InChI=1S/C21H40N2O7Si/c1-8-9-14-28-20(26)23-12-10-16(11-13-23)30-19(25)22-17(18(24)27-5)15-29-31(6,7)21(2,3)4/h16-17H,8-15H2,1-7H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | BHVITRLDAUWLGK-KRWDZBQOSA-N |
| XLogP | 3.68 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|