C23H44N2O2 — CID 150170409
methyl 4,5,5-tributyl-3,9-diazaspiro[5.5]undecane-3-carboxylate (PubChem CID 150170409) has the molecular formula C23H44N2O2 and a molecular weight of 380.62 g/mol. Its IUPAC name is methyl 4,5,5-tributyl-3,9-diazaspiro[5.5]undecane-3-carboxylate.
| Compound Name | methyl 4,5,5-tributyl-3,9-diazaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 150170409 |
| Molecular Formula | C23H44N2O2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | methyl 4,5,5-tributyl-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| SMILES | CCCCC1N(C(=O)OC)CCC2(CCNCC2)C1(CCCC)CCCC |
| InChI | InChI=1S/C23H44N2O2/c1-5-8-11-20-23(12-9-6-2,13-10-7-3)22(14-17-24-18-15-22)16-19-25(20)21(26)27-4/h20,24H,5-19H2,1-4H3 |
| InChIKey | FJHXKJZUGGRTRU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |