About methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate
methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate (PubChem CID 83848945) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate.
Analyze methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate?
The IUPAC name of methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate (CID 83848945) is methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate.
What is the SMILES notation for methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate?
The canonical SMILES for methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate is COC(=O)N1CCC2(CCNC2)C1(C)C.
What is the InChIKey of methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate?
The InChIKey is OXOYEJLTHNUJFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-10(2)11(4-6-12-8-11)5-7-13(10)9(14)15-3/h12H,4-8H2,1-3H3.
What are the key properties of methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate?
methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate has a molecular weight of 212.29 g/mol, XLogP of 1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,1-dimethyl-2,7-diazaspiro[4.4]nonane-2-carboxylate is sourced from PubChem (CID 83848945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).