C18H36O2Si — CID 101436400
[(3R,3aS,4R)-1,1-bis(methoxymethyl)-3-methyl-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methyl-trimethylsilane (PubChem CID 101436400) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is [(3R,3aS,4R)-1,1-bis(methoxymethyl)-3-methyl-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methyl-trimethylsilane.
| Compound Name | [(3R,3aS,4R)-1,1-bis(methoxymethyl)-3-methyl-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 101436400 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | [(3R,3aS,4R)-1,1-bis(methoxymethyl)-3-methyl-2,3,3a,4,5,6,7,7a-octahydroinden-4-yl]methyl-trimethylsilane |
| SMILES | COCC1(COC)C[C@@H](C)[C@H]2C1CCC[C@H]2C[Si](C)(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-14-10-18(12-19-2,13-20-3)16-9-7-8-15(17(14)16)11-21(4,5)6/h14-17H,7-13H2,1-6H3/t14-,15+,16?,17-/m1/s1 |
| InChIKey | YYCAYISMFJSHCO-FCLJQHQZSA-N |
| XLogP | 4.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|