About methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate
methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate (PubChem CID 101436530) has the molecular formula C18H26O4
and a molecular weight of 306.40 g/mol. Its IUPAC name is methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate |
| PubChem CID | 101436530 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@@H]1C[C@H](OC)C[C@@H](Cc2ccccc2)O1 |
| InChI | InChI=1S/C18H26O4/c1-18(2,17(19)21-4)16-12-14(20-3)11-15(22-16)10-13-8-6-5-7-9-13/h5-9,14-16H,10-12H2,1-4H3/t14-,15-,16+/m1/s1 |
| InChIKey | WFFDAQROIVVWJU-OAGGEKHMSA-N |
| XLogP | 2.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate?
The IUPAC name of methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate (CID 101436530) is methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate.
What is the SMILES notation for methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate?
The canonical SMILES for methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate is COC(=O)C(C)(C)[C@@H]1C[C@H](OC)C[C@@H](Cc2ccccc2)O1.
What is the InChIKey of methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate?
The InChIKey is WFFDAQROIVVWJU-OAGGEKHMSA-N. The full InChI is InChI=1S/C18H26O4/c1-18(2,17(19)21-4)16-12-14(20-3)11-15(22-16)10-13-8-6-5-7-9-13/h5-9,14-16H,10-12H2,1-4H3/t14-,15-,16+/m1/s1.
What are the key properties of methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate?
methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate has a molecular weight of 306.40 g/mol, XLogP of 2.99, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2S,4R,6R)-6-benzyl-4-methoxyoxan-2-yl]-2-methylpropanoate is sourced from PubChem (CID 101436530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).