C23H29N3O3 — CID 101436634
(2S)-2-[(4-hydroxyphenyl)methyl]-4-(3-methoxypropyl)-1-(2-phenylethylamino)-2H-pyrazin-3-one (PubChem CID 101436634) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is (2S)-2-[(4-hydroxyphenyl)methyl]-4-(3-methoxypropyl)-1-(2-phenylethylamino)-2H-pyrazin-3-one.
| Compound Name | (2S)-2-[(4-hydroxyphenyl)methyl]-4-(3-methoxypropyl)-1-(2-phenylethylamino)-2H-pyrazin-3-one |
|---|---|
| PubChem CID | 101436634 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (2S)-2-[(4-hydroxyphenyl)methyl]-4-(3-methoxypropyl)-1-(2-phenylethylamino)-2H-pyrazin-3-one |
| SMILES | COCCCN1C=CN(NCCc2ccccc2)[C@@H](Cc2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C23H29N3O3/c1-29-17-5-14-25-15-16-26(24-13-12-19-6-3-2-4-7-19)22(23(25)28)18-20-8-10-21(27)11-9-20/h2-4,6-11,15-16,22,24,27H,5,12-14,17-18H2,1H3/t22-/m0/s1 |
| InChIKey | QCBBGYGRQLVOFE-QFIPXVFZSA-N |
| XLogP | 2.70 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|