C33H45N5O2 — CID 10143734
2-(5-cyclohexyl-2-oxo-1-propyl-3H-1,4-benzodiazepin-3-yl)-N-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]acetamide (PubChem CID 10143734) has the molecular formula C33H45N5O2 and a molecular weight of 543.76 g/mol. Its IUPAC name is 2-(5-cyclohexyl-2-oxo-1-propyl-3H-1,4-benzodiazepin-3-yl)-N-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]acetamide.
| Compound Name | 2-(5-cyclohexyl-2-oxo-1-propyl-3H-1,4-benzodiazepin-3-yl)-N-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 10143734 |
| Molecular Formula | C33H45N5O2 |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.36 |
| IUPAC Name | 2-(5-cyclohexyl-2-oxo-1-propyl-3H-1,4-benzodiazepin-3-yl)-N-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]acetamide |
| SMILES | CCCN1C(=O)C(CC(=O)Nc2ccc(N3CCC(N(C)C)CC3)cc2)N=C(C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C33H45N5O2/c1-4-20-38-30-13-9-8-12-28(30)32(24-10-6-5-7-11-24)35-29(33(38)40)23-31(39)34-25-14-16-27(17-15-25)37-21-18-26(19-22-37)36(2)3/h8-9,12-17,24,26,29H,4-7,10-11,18-23H2,1-3H3,(H,34,39) |
| InChIKey | GWNGFCGOACVMKU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|