C33H46N6O2 — CID 45111379
1-(1-butyl-5-cyclohexyl-2-oxo-3H-1,4-benzodiazepin-3-yl)-3-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]urea (PubChem CID 45111379) has the molecular formula C33H46N6O2 and a molecular weight of 558.77 g/mol. Its IUPAC name is 1-(1-butyl-5-cyclohexyl-2-oxo-3H-1,4-benzodiazepin-3-yl)-3-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]urea.
| Compound Name | 1-(1-butyl-5-cyclohexyl-2-oxo-3H-1,4-benzodiazepin-3-yl)-3-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 45111379 |
| Molecular Formula | C33H46N6O2 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.37 |
| IUPAC Name | 1-(1-butyl-5-cyclohexyl-2-oxo-3H-1,4-benzodiazepin-3-yl)-3-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]urea |
| SMILES | CCCCN1C(=O)C(NC(=O)Nc2ccc(N3CCC(N(C)C)CC3)cc2)N=C(C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C33H46N6O2/c1-4-5-21-39-29-14-10-9-13-28(29)30(24-11-7-6-8-12-24)35-31(32(39)40)36-33(41)34-25-15-17-27(18-16-25)38-22-19-26(20-23-38)37(2)3/h9-10,13-18,24,26,31H,4-8,11-12,19-23H2,1-3H3,(H2,34,36,41) |
| InChIKey | NXGDBKFPPLAPHD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|