C20H20O11 — CID 101437825
3,3-dimethyl-9,10-dioxo-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraene-7-carboxylic acid (PubChem CID 101437825) has the molecular formula C20H20O11 and a molecular weight of 436.37 g/mol. Its IUPAC name is 3,3-dimethyl-9,10-dioxo-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraene-7-carboxylic acid.
| Compound Name | 3,3-dimethyl-9,10-dioxo-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraene-7-carboxylic acid |
|---|---|
| PubChem CID | 101437825 |
| Molecular Formula | C20H20O11 |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 3,3-dimethyl-9,10-dioxo-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12)-tetraene-7-carboxylic acid |
| SMILES | CC1(C)OC2=CC(=O)C(=O)c3c(C(=O)O)c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc1c32 |
| InChI | InChI=1S/C20H20O11/c1-20(2)6-3-8(29-19-17(26)16(25)15(24)10(5-21)30-19)12(18(27)28)13-11(6)9(31-20)4-7(22)14(13)23/h3-4,10,15-17,19,21,24-26H,5H2,1-2H3,(H,27,28)/t10-,15-,16+,17-,19-/m1/s1 |
| InChIKey | IYIPRRDYXFXYFP-FQUXEWKYSA-N |
| XLogP | -1.06 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|