C26H34O7 — CID 139969553
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-[5-methyl-2-(2,4,4,7-tetramethyl-3H-chromen-2-yl)phenoxy]oxane-3,4,5-triol (PubChem CID 139969553) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[5-methyl-2-(2,4,4,7-tetramethyl-3H-chromen-2-yl)phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[5-methyl-2-(2,4,4,7-tetramethyl-3H-chromen-2-yl)phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 139969553 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[5-methyl-2-(2,4,4,7-tetramethyl-3H-chromen-2-yl)phenoxy]oxane-3,4,5-triol |
| SMILES | Cc1ccc2c(c1)OC(C)(c1ccc(C)cc1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CC2(C)C |
| InChI | InChI=1S/C26H34O7/c1-14-7-9-17(18(10-14)31-24-23(30)22(29)21(28)20(12-27)32-24)26(5)13-25(3,4)16-8-6-15(2)11-19(16)33-26/h6-11,20-24,27-30H,12-13H2,1-5H3/t20-,21-,22+,23-,24?,26?/m1/s1 |
| InChIKey | NLFQICVSGKQLIH-SXMDYVCZSA-N |
| XLogP | 2.46 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |