C21H34O7 — CID 11069360
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-[(2S)-6-hydroxy-6-methylheptan-2-yl]-5-methylphenoxy]oxane-3,4,5-triol (PubChem CID 11069360) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-[(2S)-6-hydroxy-6-methylheptan-2-yl]-5-methylphenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-[(2S)-6-hydroxy-6-methylheptan-2-yl]-5-methylphenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11069360 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-[(2S)-6-hydroxy-6-methylheptan-2-yl]-5-methylphenoxy]oxane-3,4,5-triol |
| SMILES | Cc1ccc([C@@H](C)CCCC(C)(C)O)c(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C21H34O7/c1-12-7-8-14(13(2)6-5-9-21(3,4)26)15(10-12)27-20-19(25)18(24)17(23)16(11-22)28-20/h7-8,10,13,16-20,22-26H,5-6,9,11H2,1-4H3/t13-,16+,17+,18-,19+,20-/m0/s1 |
| InChIKey | WVFAYEGQLHJQDB-NUEONSHGSA-N |
| XLogP | 1.22 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |