C24H28O8 — CID 146683959
1-hydroxy-2,8,10,10-tetramethyl-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-9-one (PubChem CID 146683959) has the molecular formula C24H28O8 and a molecular weight of 444.48 g/mol. Its IUPAC name is 1-hydroxy-2,8,10,10-tetramethyl-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-9-one.
| Compound Name | 1-hydroxy-2,8,10,10-tetramethyl-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-9-one |
|---|---|
| PubChem CID | 146683959 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-hydroxy-2,8,10,10-tetramethyl-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracen-9-one |
| SMILES | Cc1ccc2c(c1O)C(=O)c1c(C)cc(O[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)cc1C2(C)C |
| InChI | InChI=1S/C24H28O8/c1-10-5-6-13-17(18(10)26)20(28)16-11(2)7-12(8-14(16)24(13,3)4)31-23-22(30)21(29)19(27)15(9-25)32-23/h5-8,15,19,21-23,25-27,29-30H,9H2,1-4H3/t15-,19+,21+,22-,23+/m1/s1 |
| InChIKey | MKUVTEGBXCAVFG-ACYMDBPDSA-N |
| XLogP | 1.06 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |