C21H16ClN3OS — CID 101438306
3-(4-chlorophenoxy)-4-[(4-phenylphenyl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 101438306) has the molecular formula C21H16ClN3OS and a molecular weight of 393.90 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)-4-[(4-phenylphenyl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-chlorophenoxy)-4-[(4-phenylphenyl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 101438306 |
| Molecular Formula | C21H16ClN3OS |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 3-(4-chlorophenoxy)-4-[(4-phenylphenyl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(Oc2ccc(Cl)cc2)n1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16ClN3OS/c22-18-10-12-19(13-11-18)26-20-23-24-21(27)25(20)14-15-6-8-17(9-7-15)16-4-2-1-3-5-16/h1-13H,14H2,(H,24,27) |
| InChIKey | HAXJEYJTMQEWDJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|