C15H11ClN4S — CID 141384758
4-[(4-chlorophenyl)methyl]-2H-[1,2,4]triazolo[4,3-a]benzimidazole-1-thione (PubChem CID 141384758) has the molecular formula C15H11ClN4S and a molecular weight of 314.80 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2H-[1,2,4]triazolo[4,3-a]benzimidazole-1-thione.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2H-[1,2,4]triazolo[4,3-a]benzimidazole-1-thione |
|---|---|
| PubChem CID | 141384758 |
| Molecular Formula | C15H11ClN4S |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2H-[1,2,4]triazolo[4,3-a]benzimidazole-1-thione |
| SMILES | S=c1[nH]nc2n(Cc3ccc(Cl)cc3)c3ccccc3n12 |
| InChI | InChI=1S/C15H11ClN4S/c16-11-7-5-10(6-8-11)9-19-12-3-1-2-4-13(12)20-14(19)17-18-15(20)21/h1-8H,9H2,(H,18,21) |
| InChIKey | PWQXSBATWJJDAN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|