C16H11FN4O2 — CID 10979812
10-[(4-fluorophenyl)methyl]-2H-[1,2,4]triazino[4,3-a]benzimidazole-3,4-dione (PubChem CID 10979812) has the molecular formula C16H11FN4O2 and a molecular weight of 310.29 g/mol. Its IUPAC name is 10-[(4-fluorophenyl)methyl]-2H-[1,2,4]triazino[4,3-a]benzimidazole-3,4-dione.
| Compound Name | 10-[(4-fluorophenyl)methyl]-2H-[1,2,4]triazino[4,3-a]benzimidazole-3,4-dione |
|---|---|
| PubChem CID | 10979812 |
| Molecular Formula | C16H11FN4O2 |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 10-[(4-fluorophenyl)methyl]-2H-[1,2,4]triazino[4,3-a]benzimidazole-3,4-dione |
| SMILES | O=c1[nH]nc2n(Cc3ccc(F)cc3)c3ccccc3n2c1=O |
| InChI | InChI=1S/C16H11FN4O2/c17-11-7-5-10(6-8-11)9-20-12-3-1-2-4-13(12)21-15(23)14(22)18-19-16(20)21/h1-8H,9H2,(H,18,22) |
| InChIKey | JXJSSLQHRUVSEN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|