C60H64N2O4P2 — CID 101439557
1,4-bis(6,20-ditert-butyl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaen-13-yl)piperazine (PubChem CID 101439557) has the molecular formula C60H64N2O4P2 and a molecular weight of 939.13 g/mol. Its IUPAC name is 1,4-bis(6,20-ditert-butyl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaen-13-yl)piperazine.
| Compound Name | 1,4-bis(6,20-ditert-butyl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaen-13-yl)piperazine |
|---|---|
| PubChem CID | 101439557 |
| Molecular Formula | C60H64N2O4P2 |
| Molecular Weight | 939.13 g/mol |
| Exact Mass | 938.43 |
| IUPAC Name | 1,4-bis(6,20-ditert-butyl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaen-13-yl)piperazine |
| SMILES | CC(C)(C)c1ccc2c(ccc3op(N4CCN(p5oc6ccc7cc(C(C)(C)C)ccc7c6c6c(ccc7cc(C(C)(C)C)ccc76)o5)CC4)oc4ccc5cc(C(C)(C)C)ccc5c4c32)c1 |
| InChI | InChI=1S/C60H64N2O4P2/c1-57(2,3)41-17-21-45-37(33-41)13-25-49-53(45)54-46-22-18-42(58(4,5)6)34-38(46)14-26-50(54)64-67(63-49)61-29-31-62(32-30-61)68-65-51-27-15-39-35-43(59(7,8)9)19-23-47(39)55(51)56-48-24-20-44(60(10,11)12)36-40(48)16-28-52(56)66-68/h13-28,33-36H,29-32H2,1-12H3 |
| InChIKey | XASZYOJCULDCFV-UHFFFAOYSA-N |
| XLogP | 18.29 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.13 |
| LogP ≤ 5 | 18.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |