C12H24O2S — CID 101439976
(2R,3R,6R)-2-(tert-butylsulfinylmethyl)-3,6-dimethyloxane (PubChem CID 101439976) has the molecular formula C12H24O2S and a molecular weight of 232.39 g/mol. Its IUPAC name is (2R,3R,6R)-2-(tert-butylsulfinylmethyl)-3,6-dimethyloxane.
| Compound Name | (2R,3R,6R)-2-(tert-butylsulfinylmethyl)-3,6-dimethyloxane |
|---|---|
| PubChem CID | 101439976 |
| Molecular Formula | C12H24O2S |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (2R,3R,6R)-2-(tert-butylsulfinylmethyl)-3,6-dimethyloxane |
| SMILES | C[C@@H]1CC[C@@H](C)[C@H](CS(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C12H24O2S/c1-9-6-7-10(2)14-11(9)8-15(13)12(3,4)5/h9-11H,6-8H2,1-5H3/t9-,10-,11+,15?/m1/s1 |
| InChIKey | DQRJXJBKFBCKLX-LCONVBBXSA-N |
| XLogP | 2.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |