C15H21ClOS — CID 158293424
1-[2-[(R)-tert-butylsulfinyl]-1-cyclopropylethyl]-4-chlorobenzene (PubChem CID 158293424) has the molecular formula C15H21ClOS and a molecular weight of 284.85 g/mol. Its IUPAC name is 1-[2-[(R)-tert-butylsulfinyl]-1-cyclopropylethyl]-4-chlorobenzene.
| Compound Name | 1-[2-[(R)-tert-butylsulfinyl]-1-cyclopropylethyl]-4-chlorobenzene |
|---|---|
| PubChem CID | 158293424 |
| Molecular Formula | C15H21ClOS |
| Molecular Weight | 284.85 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-[2-[(R)-tert-butylsulfinyl]-1-cyclopropylethyl]-4-chlorobenzene |
| SMILES | CC(C)(C)[S@](=O)CC(c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C15H21ClOS/c1-15(2,3)18(17)10-14(11-4-5-11)12-6-8-13(16)9-7-12/h6-9,11,14H,4-5,10H2,1-3H3/t14?,18-/m1/s1 |
| InChIKey | GLPYNPDXXRNQKN-XPKAQORNSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |