C14H9F13O2S — CID 101440915
(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-thiophen-3-yloctyl) acetate (PubChem CID 101440915) has the molecular formula C14H9F13O2S and a molecular weight of 488.27 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-thiophen-3-yloctyl) acetate.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-thiophen-3-yloctyl) acetate |
|---|---|
| PubChem CID | 101440915 |
| Molecular Formula | C14H9F13O2S |
| Molecular Weight | 488.27 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2-thiophen-3-yloctyl) acetate |
| SMILES | CC(=O)OCC(c1ccsc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H9F13O2S/c1-6(28)29-4-8(7-2-3-30-5-7)9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h2-3,5,8H,4H2,1H3 |
| InChIKey | SVHNOAXQKMJWCY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.27 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|