C13H9F13OS — CID 11091777
4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-thiophen-3-ylnonan-1-ol (PubChem CID 11091777) has the molecular formula C13H9F13OS and a molecular weight of 460.26 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-thiophen-3-ylnonan-1-ol.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-thiophen-3-ylnonan-1-ol |
|---|---|
| PubChem CID | 11091777 |
| Molecular Formula | C13H9F13OS |
| Molecular Weight | 460.26 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-1-thiophen-3-ylnonan-1-ol |
| SMILES | OC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccsc1 |
| InChI | InChI=1S/C13H9F13OS/c14-8(15,3-1-7(27)6-2-4-28-5-6)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h2,4-5,7,27H,1,3H2 |
| InChIKey | BWNLHPVXBKQDJB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.26 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|