C11H5F13OS — CID 46934302
3-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)thiophene (PubChem CID 46934302) has the molecular formula C11H5F13OS and a molecular weight of 432.20 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)thiophene.
| Compound Name | 3-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)thiophene |
|---|---|
| PubChem CID | 46934302 |
| Molecular Formula | C11H5F13OS |
| Molecular Weight | 432.20 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 3-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)thiophene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COc1ccsc1 |
| InChI | InChI=1S/C11H5F13OS/c12-6(13,4-25-5-1-2-26-3-5)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h1-3H,4H2 |
| InChIKey | AKBATUNDEXTNBC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.20 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|