C30H14F34N2O2 — CID 24769912
4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxymethyl)-2-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxymethyl)-2-pyridinyl]pyridine (PubChem CID 24769912) has the molecular formula C30H14F34N2O2 and a molecular weight of 1080.39 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxymethyl)-2-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxymethyl)-2-pyridinyl]pyridine.
| Compound Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxymethyl)-2-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxymethyl)-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 24769912 |
| Molecular Formula | C30H14F34N2O2 |
| Molecular Weight | 1080.39 g/mol |
| Exact Mass | 1080.05 |
| IUPAC Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxymethyl)-2-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxymethyl)-2-pyridinyl]pyridine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COCc1ccnc(-c2cc(COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccn2)c1 |
| InChI | InChI=1S/C30H14F34N2O2/c31-15(32,17(35,36)19(39,40)21(43,44)23(47,48)25(51,52)27(55,56)29(59,60)61)9-67-7-11-1-3-65-13(5-11)14-6-12(2-4-66-14)8-68-10-16(33,34)18(37,38)20(41,42)22(45,46)24(49,50)26(53,54)28(57,58)30(62,63)64/h1-6H,7-10H2 |
| InChIKey | UMAZFJVSHMNBRT-UHFFFAOYSA-N |
| XLogP | 13.20 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1080.39 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|