C10H12F3NO2S — CID 79265960
2-[1-thiophen-3-ylethyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79265960) has the molecular formula C10H12F3NO2S and a molecular weight of 267.27 g/mol. Its IUPAC name is 2-[1-thiophen-3-ylethyl(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[1-thiophen-3-ylethyl(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79265960 |
| Molecular Formula | C10H12F3NO2S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-[1-thiophen-3-ylethyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CC(c1ccsc1)N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C10H12F3NO2S/c1-7(8-2-3-17-5-8)14(4-9(15)16)6-10(11,12)13/h2-3,5,7H,4,6H2,1H3,(H,15,16) |
| InChIKey | AJJFWWYBWDTGIG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |