C13H16F3NO3 — CID 79266725
2-[1-(2-hydroxy-5-methylphenyl)ethyl-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79266725) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-[1-(2-hydroxy-5-methylphenyl)ethyl-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[1-(2-hydroxy-5-methylphenyl)ethyl-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79266725 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[1-(2-hydroxy-5-methylphenyl)ethyl-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | Cc1ccc(O)c(C(C)N(CC(=O)O)CC(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO3/c1-8-3-4-11(18)10(5-8)9(2)17(6-12(19)20)7-13(14,15)16/h3-5,9,18H,6-7H2,1-2H3,(H,19,20) |
| InChIKey | FTNXOTIVVITELB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|