C20H26O3 — CID 101441637
(2S,3S)-1,1-dimethoxy-2-methyl-2,5-diphenylpentan-3-ol (PubChem CID 101441637) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2S,3S)-1,1-dimethoxy-2-methyl-2,5-diphenylpentan-3-ol.
| Compound Name | (2S,3S)-1,1-dimethoxy-2-methyl-2,5-diphenylpentan-3-ol |
|---|---|
| PubChem CID | 101441637 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (2S,3S)-1,1-dimethoxy-2-methyl-2,5-diphenylpentan-3-ol |
| SMILES | COC(OC)[C@@](C)(c1ccccc1)[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C20H26O3/c1-20(19(22-2)23-3,17-12-8-5-9-13-17)18(21)15-14-16-10-6-4-7-11-16/h4-13,18-19,21H,14-15H2,1-3H3/t18-,20-/m0/s1 |
| InChIKey | KTGBYPFYOVNYGL-ICSRJNTNSA-N |
| XLogP | 3.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|