C16H23NO2 — CID 15786597
(4R,6R)-4,6-dihydroxy-5,5-dimethyl-8-phenyloctanenitrile (PubChem CID 15786597) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is (4R,6R)-4,6-dihydroxy-5,5-dimethyl-8-phenyloctanenitrile.
| Compound Name | (4R,6R)-4,6-dihydroxy-5,5-dimethyl-8-phenyloctanenitrile |
|---|---|
| PubChem CID | 15786597 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (4R,6R)-4,6-dihydroxy-5,5-dimethyl-8-phenyloctanenitrile |
| SMILES | CC(C)([C@H](O)CCC#N)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-16(2,14(18)9-6-12-17)15(19)11-10-13-7-4-3-5-8-13/h3-5,7-8,14-15,18-19H,6,9-11H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | JDPXNXZYLVNYEW-HUUCEWRRSA-N |
| XLogP | 2.67 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |