C26H25ClN2O6S2 — CID 10144327
butyl [4-[12-chloro-11-[(2,5-dioxopyrrolidin-1-yl)methyl]-5-oxo-5λ4,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-13-yl]phenyl] carbonate (PubChem CID 10144327) has the molecular formula C26H25ClN2O6S2 and a molecular weight of 561.08 g/mol. Its IUPAC name is butyl [4-[12-chloro-11-[(2,5-dioxopyrrolidin-1-yl)methyl]-5-oxo-5λ4,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-13-yl]phenyl] carbonate.
| Compound Name | butyl [4-[12-chloro-11-[(2,5-dioxopyrrolidin-1-yl)methyl]-5-oxo-5λ4,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-13-yl]phenyl] carbonate |
|---|---|
| PubChem CID | 10144327 |
| Molecular Formula | C26H25ClN2O6S2 |
| Molecular Weight | 561.08 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | butyl [4-[12-chloro-11-[(2,5-dioxopyrrolidin-1-yl)methyl]-5-oxo-5λ4,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-13-yl]phenyl] carbonate |
| SMILES | CCCCOC(=O)Oc1ccc(-c2c(Cl)c(CN3C(=O)CCC3=O)nc3sc4c(c23)CCS(=O)C4)cc1 |
| InChI | InChI=1S/C26H25ClN2O6S2/c1-2-3-11-34-26(32)35-16-6-4-15(5-7-16)22-23-17-10-12-37(33)14-19(17)36-25(23)28-18(24(22)27)13-29-20(30)8-9-21(29)31/h4-7H,2-3,8-14H2,1H3 |
| InChIKey | RTYNPTBSRBDLOF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.08 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|