C21H17ClN2O3S3 — CID 139899576
3-[[12-chloro-13-(4-methoxyphenyl)-5,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139899576) has the molecular formula C21H17ClN2O3S3 and a molecular weight of 477.03 g/mol. Its IUPAC name is 3-[[12-chloro-13-(4-methoxyphenyl)-5,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[[12-chloro-13-(4-methoxyphenyl)-5,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139899576 |
| Molecular Formula | C21H17ClN2O3S3 |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 3-[[12-chloro-13-(4-methoxyphenyl)-5,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(-c2c(Cl)c(CN3C(=O)CSC3=O)nc3sc4c(c23)CCSC4)cc1 |
| InChI | InChI=1S/C21H17ClN2O3S3/c1-27-12-4-2-11(3-5-12)17-18-13-6-7-28-9-15(13)30-20(18)23-14(19(17)22)8-24-16(25)10-29-21(24)26/h2-5H,6-10H2,1H3 |
| InChIKey | WSXCYYHMGYIZIW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|