C23H19ClN2O6S2 — CID 22048225
2-[4-[12-chloro-11-[(2,5-dioxopyrrolidin-1-yl)methyl]-5,5-dioxo-5λ6,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-13-yl]phenyl]acetic acid (PubChem CID 22048225) has the molecular formula C23H19ClN2O6S2 and a molecular weight of 519.00 g/mol. Its IUPAC name is 2-[4-[12-chloro-11-[(2,5-dioxopyrrolidin-1-yl)methyl]-5,5-dioxo-5λ6,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-13-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[12-chloro-11-[(2,5-dioxopyrrolidin-1-yl)methyl]-5,5-dioxo-5λ6,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-13-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 22048225 |
| Molecular Formula | C23H19ClN2O6S2 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | 2-[4-[12-chloro-11-[(2,5-dioxopyrrolidin-1-yl)methyl]-5,5-dioxo-5λ6,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-13-yl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2c(Cl)c(CN3C(=O)CCC3=O)nc3sc4c(c23)CCS(=O)(=O)C4)cc1 |
| InChI | InChI=1S/C23H19ClN2O6S2/c24-22-15(10-26-17(27)5-6-18(26)28)25-23-21(14-7-8-34(31,32)11-16(14)33-23)20(22)13-3-1-12(2-4-13)9-19(29)30/h1-4H,5-11H2,(H,29,30) |
| InChIKey | MAYQSEWAXRLPFL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|