C21H17ClN2O4S2 — CID 22048187
1-[(12-chloro-5,5-dioxo-13-phenyl-5λ6,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 22048187) has the molecular formula C21H17ClN2O4S2 and a molecular weight of 460.96 g/mol. Its IUPAC name is 1-[(12-chloro-5,5-dioxo-13-phenyl-5λ6,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(12-chloro-5,5-dioxo-13-phenyl-5λ6,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 22048187 |
| Molecular Formula | C21H17ClN2O4S2 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 1-[(12-chloro-5,5-dioxo-13-phenyl-5λ6,8-dithia-10-azatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1Cc1nc2sc3c(c2c(-c2ccccc2)c1Cl)CCS(=O)(=O)C3 |
| InChI | InChI=1S/C21H17ClN2O4S2/c22-20-14(10-24-16(25)6-7-17(24)26)23-21-19(18(20)12-4-2-1-3-5-12)13-8-9-30(27,28)11-15(13)29-21/h1-5H,6-11H2 |
| InChIKey | UTIGJLZUNCZFFF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|