C28H26ClN3O4S — CID 139756651
N-[[5-benzyl-12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]-N-formylformamide (PubChem CID 139756651) has the molecular formula C28H26ClN3O4S and a molecular weight of 536.05 g/mol. Its IUPAC name is N-[[5-benzyl-12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]-N-formylformamide.
| Compound Name | N-[[5-benzyl-12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]-N-formylformamide |
|---|---|
| PubChem CID | 139756651 |
| Molecular Formula | C28H26ClN3O4S |
| Molecular Weight | 536.05 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | N-[[5-benzyl-12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]-N-formylformamide |
| SMILES | COc1ccc(-c2c(Cl)c(CN(C=O)C=O)nc3sc4c(c23)CCN(Cc2ccccc2)C4)cc1OC |
| InChI | InChI=1S/C28H26ClN3O4S/c1-35-22-9-8-19(12-23(22)36-2)25-26-20-10-11-31(13-18-6-4-3-5-7-18)15-24(20)37-28(26)30-21(27(25)29)14-32(16-33)17-34/h3-9,12,16-17H,10-11,13-15H2,1-2H3 |
| InChIKey | ULHAYFKYQUWVKC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.05 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|