C21H24ClN3O2S — CID 54236504
N-[[12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]ethanamine (PubChem CID 54236504) has the molecular formula C21H24ClN3O2S and a molecular weight of 417.96 g/mol. Its IUPAC name is N-[[12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]ethanamine.
| Compound Name | N-[[12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 54236504 |
| Molecular Formula | C21H24ClN3O2S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-[[12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]ethanamine |
| SMILES | CCNCc1nc2sc3c(c2c(-c2ccc(OC)c(OC)c2)c1Cl)CCNC3 |
| InChI | InChI=1S/C21H24ClN3O2S/c1-4-23-10-14-20(22)18(12-5-6-15(26-2)16(9-12)27-3)19-13-7-8-24-11-17(13)28-21(19)25-14/h5-6,9,23-24H,4,7-8,10-11H2,1-3H3 |
| InChIKey | QMYFHOROVXSJGZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |