C32H30ClN3O4S2 — CID 12043617
N-[[5-benzyl-12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]benzenesulfonamide (PubChem CID 12043617) has the molecular formula C32H30ClN3O4S2 and a molecular weight of 620.20 g/mol. Its IUPAC name is N-[[5-benzyl-12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]benzenesulfonamide.
| Compound Name | N-[[5-benzyl-12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 12043617 |
| Molecular Formula | C32H30ClN3O4S2 |
| Molecular Weight | 620.20 g/mol |
| Exact Mass | 619.14 |
| IUPAC Name | N-[[5-benzyl-12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2c(Cl)c(CNS(=O)(=O)c3ccccc3)nc3sc4c(c23)CCN(Cc2ccccc2)C4)cc1OC |
| InChI | InChI=1S/C32H30ClN3O4S2/c1-39-26-14-13-22(17-27(26)40-2)29-30-24-15-16-36(19-21-9-5-3-6-10-21)20-28(24)41-32(30)35-25(31(29)33)18-34-42(37,38)23-11-7-4-8-12-23/h3-14,17,34H,15-16,18-20H2,1-2H3 |
| InChIKey | OPQSBTWZONPHIL-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.20 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |