C19H18Cl2N2O2S — CID 54556424
12-chloro-11-(chloromethyl)-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene (PubChem CID 54556424) has the molecular formula C19H18Cl2N2O2S and a molecular weight of 409.34 g/mol. Its IUPAC name is 12-chloro-11-(chloromethyl)-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene.
| Compound Name | 12-chloro-11-(chloromethyl)-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene |
|---|---|
| PubChem CID | 54556424 |
| Molecular Formula | C19H18Cl2N2O2S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 12-chloro-11-(chloromethyl)-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene |
| SMILES | COc1ccc(-c2c(Cl)c(CCl)nc3sc4c(c23)CCNC4)cc1OC |
| InChI | InChI=1S/C19H18Cl2N2O2S/c1-24-13-4-3-10(7-14(13)25-2)16-17-11-5-6-22-9-15(11)26-19(17)23-12(8-20)18(16)21/h3-4,7,22H,5-6,8-9H2,1-2H3 |
| InChIKey | ZNMFWHFHABNASK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|