C24H25N5O4S — CID 22452773
ethyl 13-(3,4-dimethoxyphenyl)-11-(1,2,4-triazol-1-ylmethyl)-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate (PubChem CID 22452773) has the molecular formula C24H25N5O4S and a molecular weight of 479.56 g/mol. Its IUPAC name is ethyl 13-(3,4-dimethoxyphenyl)-11-(1,2,4-triazol-1-ylmethyl)-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate.
| Compound Name | ethyl 13-(3,4-dimethoxyphenyl)-11-(1,2,4-triazol-1-ylmethyl)-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 22452773 |
| Molecular Formula | C24H25N5O4S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | ethyl 13-(3,4-dimethoxyphenyl)-11-(1,2,4-triazol-1-ylmethyl)-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate |
| SMILES | CCOC(=O)c1c(Cn2cncn2)nc2sc3c(c2c1-c1ccc(OC)c(OC)c1)CNCC3 |
| InChI | InChI=1S/C24H25N5O4S/c1-4-33-24(30)22-16(11-29-13-26-12-27-29)28-23-21(15-10-25-8-7-19(15)34-23)20(22)14-5-6-17(31-2)18(9-14)32-3/h5-6,9,12-13,25H,4,7-8,10-11H2,1-3H3 |
| InChIKey | FKSDTXNLFZXVPV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |