C23H20ClN3O5S — CID 59744324
(7R)-3-chloro-2-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxamide (PubChem CID 59744324) has the molecular formula C23H20ClN3O5S and a molecular weight of 485.95 g/mol. Its IUPAC name is (7R)-3-chloro-2-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxamide.
| Compound Name | (7R)-3-chloro-2-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 59744324 |
| Molecular Formula | C23H20ClN3O5S |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | (7R)-3-chloro-2-[(2,4-dioxo-1,3-oxazolidin-3-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxamide |
| SMILES | COc1ccc(-c2c(Cl)c(CN3C(=O)COC3=O)nc3sc4c(c23)CC[C@@H](C(N)=O)C4)cc1 |
| InChI | InChI=1S/C23H20ClN3O5S/c1-31-13-5-2-11(3-6-13)18-19-14-7-4-12(21(25)29)8-16(14)33-22(19)26-15(20(18)24)9-27-17(28)10-32-23(27)30/h2-3,5-6,12H,4,7-10H2,1H3,(H2,25,29)/t12-/m1/s1 |
| InChIKey | HAYFGNKDVIKPFT-GFCCVEGCSA-N |
| XLogP | 3.69 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |