C26H25Cl2NO5S — CID 69317176
(7S)-3-chloro-2-(chloromethyl)-8-[(3R)-4,4-dimethyl-2-oxooxolan-3-yl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxylic acid (PubChem CID 69317176) has the molecular formula C26H25Cl2NO5S and a molecular weight of 534.46 g/mol. Its IUPAC name is (7S)-3-chloro-2-(chloromethyl)-8-[(3R)-4,4-dimethyl-2-oxooxolan-3-yl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxylic acid.
| Compound Name | (7S)-3-chloro-2-(chloromethyl)-8-[(3R)-4,4-dimethyl-2-oxooxolan-3-yl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxylic acid |
|---|---|
| PubChem CID | 69317176 |
| Molecular Formula | C26H25Cl2NO5S |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | (7S)-3-chloro-2-(chloromethyl)-8-[(3R)-4,4-dimethyl-2-oxooxolan-3-yl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxylic acid |
| SMILES | COc1ccc(-c2c(Cl)c(CCl)nc3sc4c(c23)CC[C@H](C(=O)O)C4[C@H]2C(=O)OCC2(C)C)cc1 |
| InChI | InChI=1S/C26H25Cl2NO5S/c1-26(2)11-34-25(32)20(26)19-15(24(30)31)9-8-14-18-17(12-4-6-13(33-3)7-5-12)21(28)16(10-27)29-23(18)35-22(14)19/h4-7,15,19-20H,8-11H2,1-3H3,(H,30,31)/t15-,19?,20-/m0/s1 |
| InChIKey | VXDPXUVRFCAJKD-VBSNWNEZSA-N |
| XLogP | 6.29 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|