C41H26F6N2S2+2 — CID 101443708
4-[2-[3-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(1-methylpyridin-1-ium-4-yl)ethynyl]-5-phenylthiophen-3-yl]cyclopenten-1-yl]-5-phenylthiophen-2-yl]ethynyl]-1-methylpyridin-1-ium (PubChem CID 101443708) has the molecular formula C41H26F6N2S2+2 and a molecular weight of 724.80 g/mol. Its IUPAC name is 4-[2-[3-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(1-methylpyridin-1-ium-4-yl)ethynyl]-5-phenylthiophen-3-yl]cyclopenten-1-yl]-5-phenylthiophen-2-yl]ethynyl]-1-methylpyridin-1-ium.
| Compound Name | 4-[2-[3-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(1-methylpyridin-1-ium-4-yl)ethynyl]-5-phenylthiophen-3-yl]cyclopenten-1-yl]-5-phenylthiophen-2-yl]ethynyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 101443708 |
| Molecular Formula | C41H26F6N2S2+2 |
| Molecular Weight | 724.80 g/mol |
| Exact Mass | 724.14 |
| IUPAC Name | 4-[2-[3-[3,3,4,4,5,5-hexafluoro-2-[2-[2-(1-methylpyridin-1-ium-4-yl)ethynyl]-5-phenylthiophen-3-yl]cyclopenten-1-yl]-5-phenylthiophen-2-yl]ethynyl]-1-methylpyridin-1-ium |
| SMILES | C[n+]1ccc(C#Cc2sc(-c3ccccc3)cc2C2=C(c3cc(-c4ccccc4)sc3C#Cc3cc[n+](C)cc3)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C41H26F6N2S2/c1-48-21-17-27(18-22-48)13-15-33-31(25-35(50-33)29-9-5-3-6-10-29)37-38(40(44,45)41(46,47)39(37,42)43)32-26-36(30-11-7-4-8-12-30)51-34(32)16-14-28-19-23-49(2)24-20-28/h3-12,17-26H,1-2H3/q+2 |
| InChIKey | FKAJLJITJAWCHN-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.80 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|