C18H17FN2S — CID 137635843
Cyp17-IN-1 (PubChem CID 137635843) has the molecular formula C18H17FN2S and a molecular weight of 312.40 g/mol. Its IUPAC name is 6-fluoro-2-[(4-methyl-3-pyridinyl)methyl]-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridine.
| Compound Name | Cyp17-IN-1 |
|---|---|
| PubChem CID | 137635843 |
| Molecular Formula | C18H17FN2S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 6-fluoro-2-[(4-methyl-3-pyridinyl)methyl]-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyridine |
| SMILES | CC1=C(C=NC=C1)CN2CCC3=C(C2)SC4=C3C=C(C=C4)F |
| InChI | InChI=1S/C18H17FN2S/c1-12-4-6-20-9-13(12)10-21-7-5-15-16-8-14(19)2-3-17(16)22-18(15)11-21/h2-4,6,8-9H,5,7,10-11H2,1H3 |
| InChIKey | ATNGVPCHSCNOMP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | 393 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |