C23H21N3O5 — CID 101445575
benzyl 2-(3-diazo-4-methoxy-2,4-dioxobutyl)-4-methyl-2H-quinoline-1-carboxylate (PubChem CID 101445575) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is benzyl 2-(3-diazo-4-methoxy-2,4-dioxobutyl)-4-methyl-2H-quinoline-1-carboxylate.
| Compound Name | benzyl 2-(3-diazo-4-methoxy-2,4-dioxobutyl)-4-methyl-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 101445575 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | benzyl 2-(3-diazo-4-methoxy-2,4-dioxobutyl)-4-methyl-2H-quinoline-1-carboxylate |
| SMILES | COC(=O)C(=[N+]=[N-])C(=O)CC1C=C(C)c2ccccc2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H21N3O5/c1-15-12-17(13-20(27)21(25-24)22(28)30-2)26(19-11-7-6-10-18(15)19)23(29)31-14-16-8-4-3-5-9-16/h3-12,17H,13-14H2,1-2H3 |
| InChIKey | MRBZGTCNMHMUQJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 109.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|