C16H19NO8 — CID 101445777
trimethyl 1-(4-methoxycarbonyl-3-pyridinyl)propane-1,1,3-tricarboxylate (PubChem CID 101445777) has the molecular formula C16H19NO8 and a molecular weight of 353.33 g/mol. Its IUPAC name is trimethyl 1-(4-methoxycarbonyl-3-pyridinyl)propane-1,1,3-tricarboxylate.
| Compound Name | trimethyl 1-(4-methoxycarbonyl-3-pyridinyl)propane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 101445777 |
| Molecular Formula | C16H19NO8 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | trimethyl 1-(4-methoxycarbonyl-3-pyridinyl)propane-1,1,3-tricarboxylate |
| SMILES | COC(=O)CCC(C(=O)OC)(C(=O)OC)c1cnccc1C(=O)OC |
| InChI | InChI=1S/C16H19NO8/c1-22-12(18)5-7-16(14(20)24-3,15(21)25-4)11-9-17-8-6-10(11)13(19)23-2/h6,8-9H,5,7H2,1-4H3 |
| InChIKey | LOHUIPKFMOYWOW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 118.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|