C21H30N2O2 — CID 101450013
tert-butyl (3R,4S)-3-ethyl-4-(1H-indol-2-ylmethyl)piperidine-1-carboxylate (PubChem CID 101450013) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-ethyl-4-(1H-indol-2-ylmethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-ethyl-4-(1H-indol-2-ylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 101450013 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | tert-butyl (3R,4S)-3-ethyl-4-(1H-indol-2-ylmethyl)piperidine-1-carboxylate |
| SMILES | CC[C@H]1CN(C(=O)OC(C)(C)C)CC[C@H]1Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H30N2O2/c1-5-15-14-23(20(24)25-21(2,3)4)11-10-16(15)12-18-13-17-8-6-7-9-19(17)22-18/h6-9,13,15-16,22H,5,10-12,14H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | MQYFTHDLGXZMRW-HOTGVXAUSA-N |
| XLogP | 4.99 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |