C19H26N2O3 — CID 69269361
tert-butyl 3-(hydroxymethyl)-4-indol-1-ylpiperidine-1-carboxylate (PubChem CID 69269361) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl 3-(hydroxymethyl)-4-indol-1-ylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(hydroxymethyl)-4-indol-1-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 69269361 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | tert-butyl 3-(hydroxymethyl)-4-indol-1-ylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2ccc3ccccc32)C(CO)C1 |
| InChI | InChI=1S/C19H26N2O3/c1-19(2,3)24-18(23)20-10-9-17(15(12-20)13-22)21-11-8-14-6-4-5-7-16(14)21/h4-8,11,15,17,22H,9-10,12-13H2,1-3H3 |
| InChIKey | WZTLAEFZKFQJPU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |